About 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine
2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine (PubChem CID 145217240) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine.
Molecular Properties
| Compound Name | 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine |
| PubChem CID | 145217240 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine |
| SMILES | C=Cc1cccc(C2=C(CC)CC(C)=CC=C2)n1 |
| InChI | InChI=1S/C17H19N/c1-4-14-12-13(3)8-6-10-16(14)17-11-7-9-15(5-2)18-17/h5-11H,2,4,12H2,1,3H3 |
| InChIKey | DNTKADGPNKQXDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine?
The IUPAC name of 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine (CID 145217240) is 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine.
What is the SMILES notation for 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine?
The canonical SMILES for 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine is C=Cc1cccc(C2=C(CC)CC(C)=CC=C2)n1.
What is the InChIKey of 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine?
The InChIKey is DNTKADGPNKQXDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N/c1-4-14-12-13(3)8-6-10-16(14)17-11-7-9-15(5-2)18-17/h5-11H,2,4,12H2,1,3H3.
What are the key properties of 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine?
2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine has a molecular weight of 237.35 g/mol, XLogP of 4.79, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-6-(2-ethyl-4-methylcyclohepta-1,4,6-trien-1-yl)pyridine is sourced from PubChem (CID 145217240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).