C13H18N2S2 — CID 145217295
4-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylmethylsulfanyl]cyclohexa-1,3-dien-1-amine (PubChem CID 145217295) has the molecular formula C13H18N2S2 and a molecular weight of 266.44 g/mol. Its IUPAC name is 4-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylmethylsulfanyl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 4-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylmethylsulfanyl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145217295 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.44 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylmethylsulfanyl]cyclohexa-1,3-dien-1-amine |
| SMILES | C=C(N)/C=C\C(=C)SCSC1=CC=C(N)CC1 |
| InChI | InChI=1S/C13H18N2S2/c1-10(14)3-4-11(2)16-9-17-13-7-5-12(15)6-8-13/h3-5,7H,1-2,6,8-9,14-15H2/b4-3- |
| InChIKey | IRBMVROZQBSCIJ-ARJAWSKDSA-N |
| XLogP | 3.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|