C12H16N2S — CID 145217319
4-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-amine (PubChem CID 145217319) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 4-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145217319 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 4-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]sulfanylcyclohexa-1,3-dien-1-amine |
| SMILES | C=C(N)/C=C\C(=C)SC1=CC=C(N)CC1 |
| InChI | InChI=1S/C12H16N2S/c1-9(13)3-4-10(2)15-12-7-5-11(14)6-8-12/h3-5,7H,1-2,6,8,13-14H2/b4-3- |
| InChIKey | QNGYCPVBHRAHDN-ARJAWSKDSA-N |
| XLogP | 2.78 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|