About 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine
3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine (PubChem CID 145217688) has the molecular formula C26H28N4O
and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine.
Molecular Properties
| Compound Name | 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine |
| PubChem CID | 145217688 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine |
| SMILES | Cc1cccc(C(N)=O)c1-c1cc(-c2ccccc2)n[nH]1.NCCCc1ccccc1 |
| InChI | InChI=1S/C17H15N3O.C9H13N/c1-11-6-5-9-13(17(18)21)16(11)15-10-14(19-20-15)12-7-3-2-4-8-12;10-8-4-7-9-5-2-1-3-6-9/h2-10H,1H3,(H2,18,21)(H,19,20);1-3,5-6H,4,7-8,10H2 |
| InChIKey | DTRNSFNVOAIEPJ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine?
The IUPAC name of 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine (CID 145217688) is 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine.
What is the SMILES notation for 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine?
The canonical SMILES for 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine is Cc1cccc(C(N)=O)c1-c1cc(-c2ccccc2)n[nH]1.NCCCc1ccccc1.
What is the InChIKey of 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine?
The InChIKey is DTRNSFNVOAIEPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O.C9H13N/c1-11-6-5-9-13(17(18)21)16(11)15-10-14(19-20-15)12-7-3-2-4-8-12;10-8-4-7-9-5-2-1-3-6-9/h2-10H,1H3,(H2,18,21)(H,19,20);1-3,5-6H,4,7-8,10H2.
What are the key properties of 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine?
3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine has a molecular weight of 412.54 g/mol, XLogP of 4.73, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(3-phenyl-1H-pyrazol-5-yl)benzamide;3-phenylpropan-1-amine is sourced from PubChem (CID 145217688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).