C21H23F3O2 — CID 145218625
(3Z,5Z,10E,12Z)-2,10-dimethyl-9-methylidene-11-[(2E)-1,1,1-trifluoropenta-2,4-dien-2-yl]-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one (PubChem CID 145218625) has the molecular formula C21H23F3O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is (3Z,5Z,10E,12Z)-2,10-dimethyl-9-methylidene-11-[(2E)-1,1,1-trifluoropenta-2,4-dien-2-yl]-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one.
| Compound Name | (3Z,5Z,10E,12Z)-2,10-dimethyl-9-methylidene-11-[(2E)-1,1,1-trifluoropenta-2,4-dien-2-yl]-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 145218625 |
| Molecular Formula | C21H23F3O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (3Z,5Z,10E,12Z)-2,10-dimethyl-9-methylidene-11-[(2E)-1,1,1-trifluoropenta-2,4-dien-2-yl]-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
| SMILES | C=C/C=C(C1=C(/C)C(=C)C(=O)C/C=C\C=C/C(C)OC/C=C\1)/C(F)(F)F |
| InChI | InChI=1S/C21H23F3O2/c1-5-10-19(21(22,23)24)18-12-9-14-26-15(2)11-7-6-8-13-20(25)17(4)16(18)3/h5-12,15H,1,4,13-14H2,2-3H3/b8-6-,11-7-,12-9-,18-16+,19-10+ |
| InChIKey | PWSUQRMKYDUBRK-TXNQKIFMSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|