C21H27FO2 — CID 145218689
(3Z,5Z,10Z,12Z)-5-ethyl-6-[(Z)-3-fluoroprop-1-enyl]-9,9-dimethyl-7-methylidene-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one (PubChem CID 145218689) has the molecular formula C21H27FO2 and a molecular weight of 330.44 g/mol. Its IUPAC name is (3Z,5Z,10Z,12Z)-5-ethyl-6-[(Z)-3-fluoroprop-1-enyl]-9,9-dimethyl-7-methylidene-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one.
| Compound Name | (3Z,5Z,10Z,12Z)-5-ethyl-6-[(Z)-3-fluoroprop-1-enyl]-9,9-dimethyl-7-methylidene-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
|---|---|
| PubChem CID | 145218689 |
| Molecular Formula | C21H27FO2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | (3Z,5Z,10Z,12Z)-5-ethyl-6-[(Z)-3-fluoroprop-1-enyl]-9,9-dimethyl-7-methylidene-1-oxacyclotetradeca-3,5,10,12-tetraen-8-one |
| SMILES | C=C1C(=O)C(C)(C)/C=C\C=C/COC/C=C\C(CC)=C1\C=C/CF |
| InChI | InChI=1S/C21H27FO2/c1-5-18-11-10-16-24-15-8-6-7-13-21(3,4)20(23)17(2)19(18)12-9-14-22/h6-13H,2,5,14-16H2,1,3-4H3/b8-6-,11-10-,12-9-,13-7-,19-18- |
| InChIKey | IYKGTHPWXOWUQL-NFGMCDDYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|