C20H27F3O2 — CID 145218748
(2Z,4Z,8Z,10Z)-12-[(Z)-but-2-enoxy]-4-ethylidene-7-methyl-7-(trifluoromethyl)dodeca-2,8,10-trien-6-one (PubChem CID 145218748) has the molecular formula C20H27F3O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is (2Z,4Z,8Z,10Z)-12-[(Z)-but-2-enoxy]-4-ethylidene-7-methyl-7-(trifluoromethyl)dodeca-2,8,10-trien-6-one.
| Compound Name | (2Z,4Z,8Z,10Z)-12-[(Z)-but-2-enoxy]-4-ethylidene-7-methyl-7-(trifluoromethyl)dodeca-2,8,10-trien-6-one |
|---|---|
| PubChem CID | 145218748 |
| Molecular Formula | C20H27F3O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (2Z,4Z,8Z,10Z)-12-[(Z)-but-2-enoxy]-4-ethylidene-7-methyl-7-(trifluoromethyl)dodeca-2,8,10-trien-6-one |
| SMILES | C/C=C\COC/C=C\C=C/C(C)(C(=O)CC(/C=C\C)=C/C)C(F)(F)F |
| InChI | InChI=1S/C20H27F3O2/c1-5-8-14-25-15-11-9-10-13-19(4,20(21,22)23)18(24)16-17(7-3)12-6-2/h5-13H,14-16H2,1-4H3/b8-5-,11-9-,12-6-,13-10-,17-7+ |
| InChIKey | ONRFFAFEKDHCJD-PMRWRLEQSA-N |
| XLogP | 5.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|