C20H35BN2O3 — CID 145219519
[5-amino-7-[4-(4-methoxyphenyl)piperidin-1-yl]-5-methylheptyl]boronic acid (PubChem CID 145219519) has the molecular formula C20H35BN2O3 and a molecular weight of 362.32 g/mol. Its IUPAC name is [5-amino-7-[4-(4-methoxyphenyl)piperidin-1-yl]-5-methylheptyl]boronic acid.
| Compound Name | [5-amino-7-[4-(4-methoxyphenyl)piperidin-1-yl]-5-methylheptyl]boronic acid |
|---|---|
| PubChem CID | 145219519 |
| Molecular Formula | C20H35BN2O3 |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | [5-amino-7-[4-(4-methoxyphenyl)piperidin-1-yl]-5-methylheptyl]boronic acid |
| SMILES | COc1ccc(C2CCN(CCC(C)(N)CCCCB(O)O)CC2)cc1 |
| InChI | InChI=1S/C20H35BN2O3/c1-20(22,11-3-4-13-21(24)25)12-16-23-14-9-18(10-15-23)17-5-7-19(26-2)8-6-17/h5-8,18,24-25H,3-4,9-16,22H2,1-2H3 |
| InChIKey | VZTCMYQWNYHOKW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|