C12H12N2 — CID 145220213
5-[(3Z)-penta-1,3-dien-2-yl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 145220213) has the molecular formula C12H12N2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-[(3Z)-penta-1,3-dien-2-yl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-[(3Z)-penta-1,3-dien-2-yl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 145220213 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 5-[(3Z)-penta-1,3-dien-2-yl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | C=C(/C=C\C)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C12H12N2/c1-3-4-9(2)11-7-10-5-6-13-12(10)14-8-11/h3-8H,2H2,1H3,(H,13,14)/b4-3- |
| InChIKey | UTSWNKPFUQVVPV-ARJAWSKDSA-N |
| XLogP | 3.15 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|