About [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate
[2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate (PubChem CID 14522027) has the molecular formula C12H15F3O6S2
and a molecular weight of 376.37 g/mol. Its IUPAC name is [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate |
| PubChem CID | 14522027 |
| Molecular Formula | C12H15F3O6S2 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate |
| SMILES | COCc1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(OC)c1SC |
| InChI | InChI=1S/C12H15F3O6S2/c1-18-6-7-5-8(19-2)9(10(20-3)11(7)22-4)21-23(16,17)12(13,14)15/h5H,6H2,1-4H3 |
| InChIKey | IPXMMPPOYFUXIF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate?
The IUPAC name of [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate (CID 14522027) is [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate?
The canonical SMILES for [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate is COCc1cc(OC)c(OS(=O)(=O)C(F)(F)F)c(OC)c1SC.
What is the InChIKey of [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate?
The InChIKey is IPXMMPPOYFUXIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3O6S2/c1-18-6-7-5-8(19-2)9(10(20-3)11(7)22-4)21-23(16,17)12(13,14)15/h5H,6H2,1-4H3.
What are the key properties of [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate?
[2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate has a molecular weight of 376.37 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethoxy-4-(methoxymethyl)-3-methylsulfanylphenyl] trifluoromethanesulfonate is sourced from PubChem (CID 14522027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).