About 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium
2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium (PubChem CID 145222129) has the molecular formula C8H9F3N3+
and a molecular weight of 204.17 g/mol. Its IUPAC name is 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium.
Molecular Properties
| Compound Name | 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium |
| PubChem CID | 145222129 |
| Molecular Formula | C8H9F3N3+ |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium |
| SMILES | Cc1c(CC#[NH+])c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C8H8F3N3/c1-5-6(3-4-12)7(8(9,10)11)13-14(5)2/h3H2,1-2H3/p+1 |
| InChIKey | NRRFBCFBVQPKSR-UHFFFAOYSA-O |
| XLogP | 0.06 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium?
The IUPAC name of 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium (CID 145222129) is 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium.
What is the SMILES notation for 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium?
The canonical SMILES for 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium is Cc1c(CC#[NH+])c(C(F)(F)F)nn1C.
What is the InChIKey of 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium?
The InChIKey is NRRFBCFBVQPKSR-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H8F3N3/c1-5-6(3-4-12)7(8(9,10)11)13-14(5)2/h3H2,1-2H3/p+1.
What are the key properties of 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium?
2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium has a molecular weight of 204.17 g/mol, XLogP of 0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,5-dimethyl-3-(trifluoromethyl)pyrazol-4-yl]acetonitrilium is sourced from PubChem (CID 145222129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).