About [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate
[3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate (PubChem CID 145222367) has the molecular formula C23H27ClN2O4
and a molecular weight of 430.93 g/mol. Its IUPAC name is [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate.
Molecular Properties
| Compound Name | [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate |
| PubChem CID | 145222367 |
| Molecular Formula | C23H27ClN2O4 |
| Molecular Weight | 430.93 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate |
| SMILES | CC.CC(=O)OCc1cc(Cc2cc(C)ccn2)cc2cc(Cl)cnc12.COC=O |
| InChI | InChI=1S/C19H17ClN2O2.C2H4O2.C2H6/c1-12-3-4-21-18(5-12)8-14-6-15-9-17(20)10-22-19(15)16(7-14)11-24-13(2)23;1-4-2-3;1-2/h3-7,9-10H,8,11H2,1-2H3;2H,1H3;1-2H3 |
| InChIKey | OPAUCPRAHJIWQZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate?
The IUPAC name of [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate (CID 145222367) is [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate.
What is the SMILES notation for [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate?
The canonical SMILES for [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate is CC.CC(=O)OCc1cc(Cc2cc(C)ccn2)cc2cc(Cl)cnc12.COC=O.
What is the InChIKey of [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate?
The InChIKey is OPAUCPRAHJIWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O2.C2H4O2.C2H6/c1-12-3-4-21-18(5-12)8-14-6-15-9-17(20)10-22-19(15)16(7-14)11-24-13(2)23;1-4-2-3;1-2/h3-7,9-10H,8,11H2,1-2H3;2H,1H3;1-2H3.
What are the key properties of [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate?
[3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate has a molecular weight of 430.93 g/mol, XLogP of 5.06, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-6-[(4-methyl-2-pyridinyl)methyl]quinolin-8-yl]methyl acetate;ethane;methyl formate is sourced from PubChem (CID 145222367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).