About 3,6-dimethylimidazo[1,5-a]pyrazine;ethane
3,6-dimethylimidazo[1,5-a]pyrazine;ethane (PubChem CID 145222574) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3,6-dimethylimidazo[1,5-a]pyrazine;ethane.
Molecular Properties
| Compound Name | 3,6-dimethylimidazo[1,5-a]pyrazine;ethane |
| PubChem CID | 145222574 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3,6-dimethylimidazo[1,5-a]pyrazine;ethane |
| SMILES | CC.CC.Cc1cn2c(C)ncc2cn1 |
| InChI | InChI=1S/C8H9N3.2C2H6/c1-6-5-11-7(2)10-4-8(11)3-9-6;2*1-2/h3-5H,1-2H3;2*1-2H3 |
| InChIKey | ZTXCUQPVOIYLHK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dimethylimidazo[1,5-a]pyrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethylimidazo[1,5-a]pyrazine;ethane?
The IUPAC name of 3,6-dimethylimidazo[1,5-a]pyrazine;ethane (CID 145222574) is 3,6-dimethylimidazo[1,5-a]pyrazine;ethane.
What is the SMILES notation for 3,6-dimethylimidazo[1,5-a]pyrazine;ethane?
The canonical SMILES for 3,6-dimethylimidazo[1,5-a]pyrazine;ethane is CC.CC.Cc1cn2c(C)ncc2cn1.
What is the InChIKey of 3,6-dimethylimidazo[1,5-a]pyrazine;ethane?
The InChIKey is ZTXCUQPVOIYLHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3.2C2H6/c1-6-5-11-7(2)10-4-8(11)3-9-6;2*1-2/h3-5H,1-2H3;2*1-2H3.
What are the key properties of 3,6-dimethylimidazo[1,5-a]pyrazine;ethane?
3,6-dimethylimidazo[1,5-a]pyrazine;ethane has a molecular weight of 207.32 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethylimidazo[1,5-a]pyrazine;ethane is sourced from PubChem (CID 145222574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).