C15H27N5O8S — CID 145222759
2-formamido-N-[[(2R)-piperidin-2-yl]methoxy]acetamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 145222759) has the molecular formula C15H27N5O8S and a molecular weight of 437.48 g/mol. Its IUPAC name is 2-formamido-N-[[(2R)-piperidin-2-yl]methoxy]acetamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | 2-formamido-N-[[(2R)-piperidin-2-yl]methoxy]acetamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 145222759 |
| Molecular Formula | C15H27N5O8S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-formamido-N-[[(2R)-piperidin-2-yl]methoxy]acetamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNCC(=O)NOC[C@H]1CCCCN1 |
| InChI | InChI=1S/C9H17N3O3.C6H10N2O5S/c13-7-10-5-9(14)12-15-6-8-3-1-2-4-11-8;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12/h7-8,11H,1-6H2,(H,10,13)(H,12,14);5H,1-4H2,(H,10,11,12)/t8-;/m1./s1 |
| InChIKey | XSVJRNZSUDHEDP-DDWIOCJRSA-N |
| XLogP | -1.46 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|