C17H33N5O8S — CID 145222767
ethane;3-formamido-N-(pyrrolidin-2-ylmethoxy)propanamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate (PubChem CID 145222767) has the molecular formula C17H33N5O8S and a molecular weight of 467.55 g/mol. Its IUPAC name is ethane;3-formamido-N-(pyrrolidin-2-ylmethoxy)propanamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate.
| Compound Name | ethane;3-formamido-N-(pyrrolidin-2-ylmethoxy)propanamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
|---|---|
| PubChem CID | 145222767 |
| Molecular Formula | C17H33N5O8S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | ethane;3-formamido-N-(pyrrolidin-2-ylmethoxy)propanamide;(7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl) hydrogen sulfate |
| SMILES | CC.O=C1N2CCCC(C2)N1OS(=O)(=O)O.O=CNCCC(=O)NOCC1CCCN1 |
| InChI | InChI=1S/C9H17N3O3.C6H10N2O5S.C2H6/c13-7-10-5-3-9(14)12-15-6-8-2-1-4-11-8;9-6-7-3-1-2-5(4-7)8(6)13-14(10,11)12;1-2/h7-8,11H,1-6H2,(H,10,13)(H,12,14);5H,1-4H2,(H,10,11,12);1-2H3 |
| InChIKey | QFIDTYZRAQFHPX-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|