C19H14O4-2 — CID 145222836
4-[(1E,6E)-7-(4-oxidophenyl)-3,5-dioxohepta-1,6-dienyl]phenolate (PubChem CID 145222836) has the molecular formula C19H14O4-2 and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-[(1E,6E)-7-(4-oxidophenyl)-3,5-dioxohepta-1,6-dienyl]phenolate.
| Compound Name | 4-[(1E,6E)-7-(4-oxidophenyl)-3,5-dioxohepta-1,6-dienyl]phenolate |
|---|---|
| PubChem CID | 145222836 |
| Molecular Formula | C19H14O4-2 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-[(1E,6E)-7-(4-oxidophenyl)-3,5-dioxohepta-1,6-dienyl]phenolate |
| SMILES | O=C(/C=C/c1ccc([O-])cc1)CC(=O)/C=C/c1ccc([O-])cc1 |
| InChI | InChI=1S/C19H16O4/c20-16-7-1-14(2-8-16)5-11-18(22)13-19(23)12-6-15-3-9-17(21)10-4-15/h1-12,20-21H,13H2/p-2/b11-5+,12-6+ |
| InChIKey | PREBVFJICNPEKM-YDWXAUTNSA-L |
| XLogP | 2.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|