C18H21F3N2O4S — CID 145223125
ethane;furan-2-yl-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (PubChem CID 145223125) has the molecular formula C18H21F3N2O4S and a molecular weight of 418.44 g/mol. Its IUPAC name is ethane;furan-2-yl-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone.
| Compound Name | ethane;furan-2-yl-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 145223125 |
| Molecular Formula | C18H21F3N2O4S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | ethane;furan-2-yl-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| SMILES | CC.O=C(c1ccco1)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H15F3N2O4S.C2H6/c17-16(18,19)12-3-5-13(6-4-12)26(23,24)21-9-7-20(8-10-21)15(22)14-2-1-11-25-14;1-2/h1-6,11H,7-10H2;1-2H3 |
| InChIKey | SQYJBHFLNQHQRF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |