C49H43N5 — CID 145223335
8-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-15-[3-[(2E,4Z)-nona-2,4-dien-2-yl]phenyl]-8,15-diazatetracyclo[14.4.0.02,7.09,14]icosa-1(20),2,4,6,9,11,13,16,18-nonaene (PubChem CID 145223335) has the molecular formula C49H43N5 and a molecular weight of 701.92 g/mol. Its IUPAC name is 8-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-15-[3-[(2E,4Z)-nona-2,4-dien-2-yl]phenyl]-8,15-diazatetracyclo[14.4.0.02,7.09,14]icosa-1(20),2,4,6,9,11,13,16,18-nonaene.
| Compound Name | 8-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-15-[3-[(2E,4Z)-nona-2,4-dien-2-yl]phenyl]-8,15-diazatetracyclo[14.4.0.02,7.09,14]icosa-1(20),2,4,6,9,11,13,16,18-nonaene |
|---|---|
| PubChem CID | 145223335 |
| Molecular Formula | C49H43N5 |
| Molecular Weight | 701.92 g/mol |
| Exact Mass | 701.35 |
| IUPAC Name | 8-[3-(4-methyl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-15-[3-[(2E,4Z)-nona-2,4-dien-2-yl]phenyl]-8,15-diazatetracyclo[14.4.0.02,7.09,14]icosa-1(20),2,4,6,9,11,13,16,18-nonaene |
| SMILES | CCCC/C=C\C=C(/C)c1cccc(-n2c3ccccc3c3ccccc3n(-c3cccc(-c4nc(C)nc(-c5ccccc5)n4)c3)c3ccccc32)c1 |
| InChI | InChI=1S/C49H43N5/c1-4-5-6-7-9-20-35(2)38-23-18-25-40(33-38)53-44-29-14-12-27-42(44)43-28-13-15-30-45(43)54(47-32-17-16-31-46(47)53)41-26-19-24-39(34-41)49-51-36(3)50-48(52-49)37-21-10-8-11-22-37/h7-34H,4-6H2,1-3H3/b9-7-,35-20+ |
| InChIKey | PJUVWHOBCLVCDS-WQLKAFSYSA-N |
| XLogP | 12.83 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.92 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|