C18H33N5O3 — CID 145223522
tert-butyl N-[1-[3-imino-4-(3-methylbutanimidoyl)piperazin-1-yl]-1-oxobutan-2-yl]carbamate (PubChem CID 145223522) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[1-[3-imino-4-(3-methylbutanimidoyl)piperazin-1-yl]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-imino-4-(3-methylbutanimidoyl)piperazin-1-yl]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 145223522 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | tert-butyl N-[1-[3-imino-4-(3-methylbutanimidoyl)piperazin-1-yl]-1-oxobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\CC(C)C)N1CCN(C(=O)C(CC)NC(=O)OC(C)(C)C)C/C1=N\[H] |
| InChI | InChI=1S/C18H33N5O3/c1-7-13(21-17(25)26-18(4,5)6)16(24)22-8-9-23(15(20)11-22)14(19)10-12(2)3/h12-13,19-20H,7-11H2,1-6H3,(H,21,25)/b19-14+,20-15+ |
| InChIKey | RGFIXFIPWHVMIT-PXXPDPNMSA-N |
| XLogP | 2.43 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|