About 4-ethyl-1-methyl-2,3-dihydroindol-2-ol
4-ethyl-1-methyl-2,3-dihydroindol-2-ol (PubChem CID 145223584) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-ethyl-1-methyl-2,3-dihydroindol-2-ol.
Molecular Properties
| Compound Name | 4-ethyl-1-methyl-2,3-dihydroindol-2-ol |
| PubChem CID | 145223584 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 4-ethyl-1-methyl-2,3-dihydroindol-2-ol |
| SMILES | CCc1cccc2c1CC(O)N2C |
| InChI | InChI=1S/C11H15NO/c1-3-8-5-4-6-10-9(8)7-11(13)12(10)2/h4-6,11,13H,3,7H2,1-2H3 |
| InChIKey | KNYMULCOXQYJHY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1-methyl-2,3-dihydroindol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-methyl-2,3-dihydroindol-2-ol?
The IUPAC name of 4-ethyl-1-methyl-2,3-dihydroindol-2-ol (CID 145223584) is 4-ethyl-1-methyl-2,3-dihydroindol-2-ol.
What is the SMILES notation for 4-ethyl-1-methyl-2,3-dihydroindol-2-ol?
The canonical SMILES for 4-ethyl-1-methyl-2,3-dihydroindol-2-ol is CCc1cccc2c1CC(O)N2C.
What is the InChIKey of 4-ethyl-1-methyl-2,3-dihydroindol-2-ol?
The InChIKey is KNYMULCOXQYJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-3-8-5-4-6-10-9(8)7-11(13)12(10)2/h4-6,11,13H,3,7H2,1-2H3.
What are the key properties of 4-ethyl-1-methyl-2,3-dihydroindol-2-ol?
4-ethyl-1-methyl-2,3-dihydroindol-2-ol has a molecular weight of 177.25 g/mol, XLogP of 1.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-methyl-2,3-dihydroindol-2-ol is sourced from PubChem (CID 145223584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).