C36H48 — CID 145223860
1,1-diethyl-3-methylcyclobutane;1-methyl-4-[(2Z,4E,7E)-5-methyl-6-methylidene-8-(4-prop-1-en-2-ylphenyl)nona-2,4,7-trien-4-yl]benzene (PubChem CID 145223860) has the molecular formula C36H48 and a molecular weight of 480.78 g/mol. Its IUPAC name is 1,1-diethyl-3-methylcyclobutane;1-methyl-4-[(2Z,4E,7E)-5-methyl-6-methylidene-8-(4-prop-1-en-2-ylphenyl)nona-2,4,7-trien-4-yl]benzene.
| Compound Name | 1,1-diethyl-3-methylcyclobutane;1-methyl-4-[(2Z,4E,7E)-5-methyl-6-methylidene-8-(4-prop-1-en-2-ylphenyl)nona-2,4,7-trien-4-yl]benzene |
|---|---|
| PubChem CID | 145223860 |
| Molecular Formula | C36H48 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 1,1-diethyl-3-methylcyclobutane;1-methyl-4-[(2Z,4E,7E)-5-methyl-6-methylidene-8-(4-prop-1-en-2-ylphenyl)nona-2,4,7-trien-4-yl]benzene |
| SMILES | C=C(/C=C(\C)c1ccc(C(=C)C)cc1)/C(C)=C(\C=C/C)c1ccc(C)cc1.CCC1(CC)CC(C)C1 |
| InChI | InChI=1S/C27H30.C9H18/c1-8-9-27(26-12-10-20(4)11-13-26)23(7)21(5)18-22(6)25-16-14-24(15-17-25)19(2)3;1-4-9(5-2)6-8(3)7-9/h8-18H,2,5H2,1,3-4,6-7H3;8H,4-7H2,1-3H3/b9-8-,22-18+,27-23+; |
| InChIKey | AHYLOBNIMBOCET-VROQBSJASA-N |
| XLogP | 11.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|