C20H20FN5O2 — CID 145224611
(9S)-14-fluoro-10-oxa-3,18,22,23,26-pentazapentacyclo[17.5.2.04,9.011,16.022,25]hexacosa-1(25),11(16),12,14,19(26),20,23-heptaen-2-one (PubChem CID 145224611) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is (9S)-14-fluoro-10-oxa-3,18,22,23,26-pentazapentacyclo[17.5.2.04,9.011,16.022,25]hexacosa-1(25),11(16),12,14,19(26),20,23-heptaen-2-one.
| Compound Name | (9S)-14-fluoro-10-oxa-3,18,22,23,26-pentazapentacyclo[17.5.2.04,9.011,16.022,25]hexacosa-1(25),11(16),12,14,19(26),20,23-heptaen-2-one |
|---|---|
| PubChem CID | 145224611 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (9S)-14-fluoro-10-oxa-3,18,22,23,26-pentazapentacyclo[17.5.2.04,9.011,16.022,25]hexacosa-1(25),11(16),12,14,19(26),20,23-heptaen-2-one |
| SMILES | O=C1NC2CCCC[C@@H]2Oc2ccc(F)cc2CNc2ccn3ncc1c3n2 |
| InChI | InChI=1S/C20H20FN5O2/c21-13-5-6-16-12(9-13)10-22-18-7-8-26-19(25-18)14(11-23-26)20(27)24-15-3-1-2-4-17(15)28-16/h5-9,11,15,17H,1-4,10H2,(H,22,25)(H,24,27)/t15?,17-/m0/s1 |
| InChIKey | SRTHTPJFGIFJRR-LWKPJOBUSA-N |
| XLogP | 2.91 |
| TPSA | 80.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |