About (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole
(4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole (PubChem CID 145224833) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole.
Molecular Properties
| Compound Name | (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole |
| PubChem CID | 145224833 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole |
| SMILES | C=C/C=c1/nco/c1=C/CC |
| InChI | InChI=1S/C9H11NO/c1-3-5-8-9(6-4-2)11-7-10-8/h3,5-7H,1,4H2,2H3/b8-5+,9-6+ |
| InChIKey | OBSBFZSLVMVVAX-XVYDYJIPSA-N |
| XLogP | 0.83 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole?
The IUPAC name of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole (CID 145224833) is (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole.
What is the SMILES notation for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole?
The canonical SMILES for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole is C=C/C=c1/nco/c1=C/CC.
What is the InChIKey of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole?
The InChIKey is OBSBFZSLVMVVAX-XVYDYJIPSA-N. The full InChI is InChI=1S/C9H11NO/c1-3-5-8-9(6-4-2)11-7-10-8/h3,5-7H,1,4H2,2H3/b8-5+,9-6+.
What are the key properties of (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole?
(4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole has a molecular weight of 149.19 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-4-prop-2-enylidene-5-propylidene-1,3-oxazole is sourced from PubChem (CID 145224833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).