About ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide
ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide (PubChem CID 145225023) has the molecular formula C12H20F3N3O
and a molecular weight of 279.31 g/mol. Its IUPAC name is ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide |
| PubChem CID | 145225023 |
| Molecular Formula | C12H20F3N3O |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide |
| SMILES | CC.CCc1c(CCC(F)(F)F)c(C(N)=O)nn1C |
| InChI | InChI=1S/C10H14F3N3O.C2H6/c1-3-7-6(4-5-10(11,12)13)8(9(14)17)15-16(7)2;1-2/h3-5H2,1-2H3,(H2,14,17);1-2H3 |
| InChIKey | PRVLCLAPUPFQHJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide?
The IUPAC name of ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide (CID 145225023) is ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide.
What is the SMILES notation for ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide?
The canonical SMILES for ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide is CC.CCc1c(CCC(F)(F)F)c(C(N)=O)nn1C.
What is the InChIKey of ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide?
The InChIKey is PRVLCLAPUPFQHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N3O.C2H6/c1-3-7-6(4-5-10(11,12)13)8(9(14)17)15-16(7)2;1-2/h3-5H2,1-2H3,(H2,14,17);1-2H3.
What are the key properties of ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide?
ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide has a molecular weight of 279.31 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethyl-1-methyl-4-(3,3,3-trifluoropropyl)pyrazole-3-carboxamide is sourced from PubChem (CID 145225023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).