C18H18F5N5O2 — CID 145225166
7,9-difluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one;5-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide (PubChem CID 145225166) has the molecular formula C18H18F5N5O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 7,9-difluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one;5-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide.
| Compound Name | 7,9-difluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one;5-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 145225166 |
| Molecular Formula | C18H18F5N5O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 7,9-difluoro-1,3,4,5-tetrahydro-1-benzazepin-2-one;5-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridine-2-carboxamide |
| SMILES | NC(=O)c1nc2n(n1)C(C(F)(F)F)CCC2.O=C1CCCc2cc(F)cc(F)c2N1 |
| InChI | InChI=1S/C10H9F2NO.C8H9F3N4O/c11-7-4-6-2-1-3-9(14)13-10(6)8(12)5-7;9-8(10,11)4-2-1-3-5-13-7(6(12)16)14-15(4)5/h4-5H,1-3H2,(H,13,14);4H,1-3H2,(H2,12,16) |
| InChIKey | YSUXDLJJGXPDFB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |