C9H10F3N3O2 — CID 145225283
5-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide (PubChem CID 145225283) has the molecular formula C9H10F3N3O2 and a molecular weight of 249.19 g/mol. Its IUPAC name is 5-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide.
| Compound Name | 5-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 145225283 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 5-(2,2,2-trifluoroethyl)-1,4,5,7-tetrahydropyrano[4,3-d]pyrazole-3-carboxamide |
| SMILES | NC(=O)c1n[nH]c2c1CC(CC(F)(F)F)OC2 |
| InChI | InChI=1S/C9H10F3N3O2/c10-9(11,12)2-4-1-5-6(3-17-4)14-15-7(5)8(13)16/h4H,1-3H2,(H2,13,16)(H,14,15) |
| InChIKey | LAWLYEDZZDBVKQ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |