C26H33N7O3 — CID 145225470
1-benzyl-N-[2-(2-ethoxyethyl)-4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-1,2,4-triazole-3-carboxamide;buta-1,3-diene (PubChem CID 145225470) has the molecular formula C26H33N7O3 and a molecular weight of 491.60 g/mol. Its IUPAC name is 1-benzyl-N-[2-(2-ethoxyethyl)-4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-1,2,4-triazole-3-carboxamide;buta-1,3-diene.
| Compound Name | 1-benzyl-N-[2-(2-ethoxyethyl)-4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-1,2,4-triazole-3-carboxamide;buta-1,3-diene |
|---|---|
| PubChem CID | 145225470 |
| Molecular Formula | C26H33N7O3 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.26 |
| IUPAC Name | 1-benzyl-N-[2-(2-ethoxyethyl)-4-methyl-5-oxo-7,8-dihydro-6H-pyrazolo[1,5-a][1,3]diazepin-6-yl]-1,2,4-triazole-3-carboxamide;buta-1,3-diene |
| SMILES | C=CC=C.CCOCCc1cc2n(n1)CCC(NC(=O)c1ncn(Cc3ccccc3)n1)C(=O)N2C |
| InChI | InChI=1S/C22H27N7O3.C4H6/c1-3-32-12-10-17-13-19-27(2)22(31)18(9-11-29(19)25-17)24-21(30)20-23-15-28(26-20)14-16-7-5-4-6-8-16;1-3-4-2/h4-8,13,15,18H,3,9-12,14H2,1-2H3,(H,24,30);3-4H,1-2H2 |
| InChIKey | JXSCVARZWHXEQK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|