C10H19N3O — CID 145225485
ethane;molecular hydrogen;1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanone (PubChem CID 145225485) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is ethane;molecular hydrogen;1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanone.
| Compound Name | ethane;molecular hydrogen;1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 145225485 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | ethane;molecular hydrogen;1-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)ethanone |
| SMILES | CC.CC(=O)c1nc2n(n1)CCCC2.[H][H] |
| InChI | InChI=1S/C8H11N3O.C2H6.H2/c1-6(12)8-9-7-4-2-3-5-11(7)10-8;1-2;/h2-5H2,1H3;1-2H3;1H |
| InChIKey | PCRKOMQRWYDGID-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |