C22H33N3O2 — CID 145225808
N-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-4-(azetidin-3-yloxy)benzamide;but-2-yne;ethane (PubChem CID 145225808) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is N-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-4-(azetidin-3-yloxy)benzamide;but-2-yne;ethane.
| Compound Name | N-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-4-(azetidin-3-yloxy)benzamide;but-2-yne;ethane |
|---|---|
| PubChem CID | 145225808 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | N-[(2Z,4Z)-2-aminohexa-2,4-dien-3-yl]-4-(azetidin-3-yloxy)benzamide;but-2-yne;ethane |
| SMILES | C/C=C\C(NC(=O)c1ccc(OC2CNC2)cc1)=C(/C)N.CC.CC#CC |
| InChI | InChI=1S/C16H21N3O2.C4H6.C2H6/c1-3-4-15(11(2)17)19-16(20)12-5-7-13(8-6-12)21-14-9-18-10-14;1-3-4-2;1-2/h3-8,14,18H,9-10,17H2,1-2H3,(H,19,20);1-2H3;1-2H3/b4-3-,15-11-;; |
| InChIKey | CMGUUFLYBPHPKX-DTRPNYDCSA-N |
| XLogP | 3.59 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|