C16H13F4N3OS — CID 145225862
1-(4-aminosulfanylphenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]imidazolidin-2-one (PubChem CID 145225862) has the molecular formula C16H13F4N3OS and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-(4-aminosulfanylphenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]imidazolidin-2-one.
| Compound Name | 1-(4-aminosulfanylphenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 145225862 |
| Molecular Formula | C16H13F4N3OS |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 1-(4-aminosulfanylphenyl)-3-[2-fluoro-5-(trifluoromethyl)phenyl]imidazolidin-2-one |
| SMILES | NSc1ccc(N2CCN(c3cc(C(F)(F)F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C16H13F4N3OS/c17-13-6-1-10(16(18,19)20)9-14(13)23-8-7-22(15(23)24)11-2-4-12(25-21)5-3-11/h1-6,9H,7-8,21H2 |
| InChIKey | WPDKBYOYJNULJV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|