C29H39Cl2N5O6 — CID 145226062
tert-butyl (4S,5R)-4-[[2,6-dichloro-4-[[[2-methyl-6-(propan-2-ylamino)pyridine-4-carbonyl]amino]carbamoyl]phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 145226062) has the molecular formula C29H39Cl2N5O6 and a molecular weight of 624.57 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-[[2,6-dichloro-4-[[[2-methyl-6-(propan-2-ylamino)pyridine-4-carbonyl]amino]carbamoyl]phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-[[2,6-dichloro-4-[[[2-methyl-6-(propan-2-ylamino)pyridine-4-carbonyl]amino]carbamoyl]phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 145226062 |
| Molecular Formula | C29H39Cl2N5O6 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.23 |
| IUPAC Name | tert-butyl (4S,5R)-4-[[2,6-dichloro-4-[[[2-methyl-6-(propan-2-ylamino)pyridine-4-carbonyl]amino]carbamoyl]phenoxy]methyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | Cc1cc(C(=O)NNC(=O)c2cc(Cl)c(OC[C@H]3[C@@H](C)OC(C)(C)N3C(=O)OC(C)(C)C)c(Cl)c2)cc(NC(C)C)n1 |
| InChI | InChI=1S/C29H39Cl2N5O6/c1-15(2)32-23-13-18(10-16(3)33-23)25(37)34-35-26(38)19-11-20(30)24(21(31)12-19)40-14-22-17(4)41-29(8,9)36(22)27(39)42-28(5,6)7/h10-13,15,17,22H,14H2,1-9H3,(H,32,33)(H,34,37)(H,35,38)/t17-,22+/m1/s1 |
| InChIKey | KRQOFIJVJNDXLM-VGSWGCGISA-N |
| XLogP | 5.73 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|