About 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine
2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine (PubChem CID 145226180) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine.
Molecular Properties
| Compound Name | 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine |
| PubChem CID | 145226180 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine |
| SMILES | Cc1nc(C2OCCO2)c(C)nc1CBr |
| InChI | InChI=1S/C10H13BrN2O2/c1-6-8(5-11)12-7(2)9(13-6)10-14-3-4-15-10/h10H,3-5H2,1-2H3 |
| InChIKey | GZLZPOFSXQGYMS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine?
The IUPAC name of 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine (CID 145226180) is 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine.
What is the SMILES notation for 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine?
The canonical SMILES for 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine is Cc1nc(C2OCCO2)c(C)nc1CBr.
What is the InChIKey of 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine?
The InChIKey is GZLZPOFSXQGYMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c1-6-8(5-11)12-7(2)9(13-6)10-14-3-4-15-10/h10H,3-5H2,1-2H3.
What are the key properties of 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine?
2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine has a molecular weight of 273.13 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(bromomethyl)-5-(1,3-dioxolan-2-yl)-3,6-dimethylpyrazine is sourced from PubChem (CID 145226180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).