About 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane
2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane (PubChem CID 145226475) has the molecular formula C9H18F2N2O
and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane.
Molecular Properties
| Compound Name | 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane |
| PubChem CID | 145226475 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane |
| SMILES | CC.CC1(NCC(N)=O)CC(F)(F)C1 |
| InChI | InChI=1S/C7H12F2N2O.C2H6/c1-6(11-2-5(10)12)3-7(8,9)4-6;1-2/h11H,2-4H2,1H3,(H2,10,12);1-2H3 |
| InChIKey | PPSYMRXOEDVMJJ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane?
The IUPAC name of 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane (CID 145226475) is 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane.
What is the SMILES notation for 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane?
The canonical SMILES for 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane is CC.CC1(NCC(N)=O)CC(F)(F)C1.
What is the InChIKey of 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane?
The InChIKey is PPSYMRXOEDVMJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2O.C2H6/c1-6(11-2-5(10)12)3-7(8,9)4-6;1-2/h11H,2-4H2,1H3,(H2,10,12);1-2H3.
What are the key properties of 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane?
2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane has a molecular weight of 208.25 g/mol, XLogP of 1.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,3-difluoro-1-methylcyclobutyl)amino]acetamide;ethane is sourced from PubChem (CID 145226475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).