About 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate
1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate (PubChem CID 145226545) has the molecular formula C27H36N2O2
and a molecular weight of 420.60 g/mol. Its IUPAC name is 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate.
Molecular Properties
| Compound Name | 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate |
| PubChem CID | 145226545 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate |
| SMILES | CC1(C)CCCCC1.COC(=O)c1ccc2nc(Cc3ccc(C(C)C)cc3)[nH]c2c1 |
| InChI | InChI=1S/C19H20N2O2.C8H16/c1-12(2)14-6-4-13(5-7-14)10-18-20-16-9-8-15(19(22)23-3)11-17(16)21-18;1-8(2)6-4-3-5-7-8/h4-9,11-12H,10H2,1-3H3,(H,20,21);3-7H2,1-2H3 |
| InChIKey | BFXPOTDDNRCFFD-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate?
The IUPAC name of 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate (CID 145226545) is 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate.
What is the SMILES notation for 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate?
The canonical SMILES for 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate is CC1(C)CCCCC1.COC(=O)c1ccc2nc(Cc3ccc(C(C)C)cc3)[nH]c2c1.
What is the InChIKey of 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate?
The InChIKey is BFXPOTDDNRCFFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2.C8H16/c1-12(2)14-6-4-13(5-7-14)10-18-20-16-9-8-15(19(22)23-3)11-17(16)21-18;1-8(2)6-4-3-5-7-8/h4-9,11-12H,10H2,1-3H3,(H,20,21);3-7H2,1-2H3.
What are the key properties of 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate?
1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate has a molecular weight of 420.60 g/mol, XLogP of 7.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethylcyclohexane;methyl 2-[(4-propan-2-ylphenyl)methyl]-3H-benzimidazole-5-carboxylate is sourced from PubChem (CID 145226545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).