C25H23N3O4S — CID 145226692
1-(4-cyclohexa-1,3,4,5-tetraen-1-ylsulfinylphenyl)-7,8-dimethoxy-N-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 145226692) has the molecular formula C25H23N3O4S and a molecular weight of 461.54 g/mol. Its IUPAC name is 1-(4-cyclohexa-1,3,4,5-tetraen-1-ylsulfinylphenyl)-7,8-dimethoxy-N-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | 1-(4-cyclohexa-1,3,4,5-tetraen-1-ylsulfinylphenyl)-7,8-dimethoxy-N-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 145226692 |
| Molecular Formula | C25H23N3O4S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 1-(4-cyclohexa-1,3,4,5-tetraen-1-ylsulfinylphenyl)-7,8-dimethoxy-N-methyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1CCc2cc(OC)c(OC)cc2C(c2ccc(S(=O)C3=CC=C=C=C3)cc2)=N1 |
| InChI | InChI=1S/C25H23N3O4S/c1-26-25(29)28-14-13-18-15-22(31-2)23(32-3)16-21(18)24(27-28)17-9-11-20(12-10-17)33(30)19-7-5-4-6-8-19/h5,7-12,15-16H,13-14H2,1-3H3,(H,26,29) |
| InChIKey | CJKCZTIPYHYAAT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |