C25H33F2NO2S — CID 145227103
(3S)-2-[[2,5-difluoro-4-(3-prop-2-enoxyoxetan-3-yl)phenyl]methyl]-6-[(2E,4Z)-hepta-2,4-dien-3-yl]-3-methylthiazinane (PubChem CID 145227103) has the molecular formula C25H33F2NO2S and a molecular weight of 449.61 g/mol. Its IUPAC name is (3S)-2-[[2,5-difluoro-4-(3-prop-2-enoxyoxetan-3-yl)phenyl]methyl]-6-[(2E,4Z)-hepta-2,4-dien-3-yl]-3-methylthiazinane.
| Compound Name | (3S)-2-[[2,5-difluoro-4-(3-prop-2-enoxyoxetan-3-yl)phenyl]methyl]-6-[(2E,4Z)-hepta-2,4-dien-3-yl]-3-methylthiazinane |
|---|---|
| PubChem CID | 145227103 |
| Molecular Formula | C25H33F2NO2S |
| Molecular Weight | 449.61 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (3S)-2-[[2,5-difluoro-4-(3-prop-2-enoxyoxetan-3-yl)phenyl]methyl]-6-[(2E,4Z)-hepta-2,4-dien-3-yl]-3-methylthiazinane |
| SMILES | C=CCOC1(c2cc(F)c(CN3SC(C(/C=C\CC)=C/C)CC[C@@H]3C)cc2F)COC1 |
| InChI | InChI=1S/C25H33F2NO2S/c1-5-8-9-19(7-3)24-11-10-18(4)28(31-24)15-20-13-23(27)21(14-22(20)26)25(16-29-17-25)30-12-6-2/h6-9,13-14,18,24H,2,5,10-12,15-17H2,1,3-4H3/b9-8-,19-7+/t18-,24?/m0/s1 |
| InChIKey | WKVYAICGZAUWGH-CMDQGMMJSA-N |
| XLogP | 6.31 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.61 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|