C20H27F2N3O3S — CID 145227371
1-[(E)-6-[[3-(2,2-difluoroethoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]-1,3-diazinane-2,4-dione (PubChem CID 145227371) has the molecular formula C20H27F2N3O3S and a molecular weight of 427.52 g/mol. Its IUPAC name is 1-[(E)-6-[[3-(2,2-difluoroethoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(E)-6-[[3-(2,2-difluoroethoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 145227371 |
| Molecular Formula | C20H27F2N3O3S |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[(E)-6-[[3-(2,2-difluoroethoxy)phenyl]sulfanylamino]-6-methylhept-1-enyl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(CCC/C=C/N1CCC(=O)NC1=O)NSc1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C20H27F2N3O3S/c1-20(2,10-4-3-5-11-25-12-9-18(26)23-19(25)27)24-29-16-8-6-7-15(13-16)28-14-17(21)22/h5-8,11,13,17,24H,3-4,9-10,12,14H2,1-2H3,(H,23,26,27)/b11-5+ |
| InChIKey | FFLJQBKFVXHXER-VZUCSPMQSA-N |
| XLogP | 4.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|