About propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate
propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate (PubChem CID 145227436) has the molecular formula C18H24BrF3N2O2
and a molecular weight of 437.30 g/mol. Its IUPAC name is propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate.
Molecular Properties
| Compound Name | propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate |
| PubChem CID | 145227436 |
| Molecular Formula | C18H24BrF3N2O2 |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate |
| SMILES | Cc1nc(C)c(CC(=O)OC(C)C)c(N2CCC(C(F)(F)F)CC2)c1Br |
| InChI | InChI=1S/C18H24BrF3N2O2/c1-10(2)26-15(25)9-14-11(3)23-12(4)16(19)17(14)24-7-5-13(6-8-24)18(20,21)22/h10,13H,5-9H2,1-4H3 |
| InChIKey | NYQITTWQAFDKCE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate?
The IUPAC name of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate (CID 145227436) is propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate.
What is the SMILES notation for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate?
The canonical SMILES for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate is Cc1nc(C)c(CC(=O)OC(C)C)c(N2CCC(C(F)(F)F)CC2)c1Br.
What is the InChIKey of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate?
The InChIKey is NYQITTWQAFDKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrF3N2O2/c1-10(2)26-15(25)9-14-11(3)23-12(4)16(19)17(14)24-7-5-13(6-8-24)18(20,21)22/h10,13H,5-9H2,1-4H3.
What are the key properties of propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate?
propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate has a molecular weight of 437.30 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[5-bromo-2,6-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]-3-pyridinyl]acetate is sourced from PubChem (CID 145227436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).