C26H36N5O9P — CID 145227922
[[4-[6-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]-2-pyridinyl]-2-hydroxybenzoyl]amino]methylphosphonic acid (PubChem CID 145227922) has the molecular formula C26H36N5O9P and a molecular weight of 593.57 g/mol. Its IUPAC name is [[4-[6-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]-2-pyridinyl]-2-hydroxybenzoyl]amino]methylphosphonic acid.
| Compound Name | [[4-[6-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]-2-pyridinyl]-2-hydroxybenzoyl]amino]methylphosphonic acid |
|---|---|
| PubChem CID | 145227922 |
| Molecular Formula | C26H36N5O9P |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | [[4-[6-[[[(2R)-2-[(1R)-1-[formyl(hydroxy)amino]propyl]heptanoyl]amino]methylcarbamoyl]-2-pyridinyl]-2-hydroxybenzoyl]amino]methylphosphonic acid |
| SMILES | CCCCC[C@@H](C(=O)NCNC(=O)c1cccc(-c2ccc(C(=O)NCP(=O)(O)O)c(O)c2)n1)[C@@H](CC)N(O)C=O |
| InChI | InChI=1S/C26H36N5O9P/c1-3-5-6-8-18(22(4-2)31(37)16-32)24(34)27-14-28-26(36)21-10-7-9-20(30-21)17-11-12-19(23(33)13-17)25(35)29-15-41(38,39)40/h7,9-13,16,18,22,33,37H,3-6,8,14-15H2,1-2H3,(H,27,34)(H,28,36)(H,29,35)(H2,38,39,40)/t18-,22-/m1/s1 |
| InChIKey | MVLOBSNDFDPHEJ-XMSQKQJNSA-N |
| XLogP | 1.95 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|