About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide (PubChem CID 14522795) has the molecular formula C10H22BrNO3
and a molecular weight of 284.19 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide |
| PubChem CID | 14522795 |
| Molecular Formula | C10H22BrNO3 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide |
| SMILES | CC1(C)OCC(C[N+](C)(C)CCO)O1.[Br-] |
| InChI | InChI=1S/C10H22NO3.BrH/c1-10(2)13-8-9(14-10)7-11(3,4)5-6-12;/h9,12H,5-8H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IYIDOGOYXYOUNG-UHFFFAOYSA-M |
| XLogP | -2.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide (CID 14522795) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide is CC1(C)OCC(C[N+](C)(C)CCO)O1.[Br-].
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide?
The InChIKey is IYIDOGOYXYOUNG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H22NO3.BrH/c1-10(2)13-8-9(14-10)7-11(3,4)5-6-12;/h9,12H,5-8H2,1-4H3;1H/q+1;/p-1.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide has a molecular weight of 284.19 g/mol, XLogP of -2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl-(2-hydroxyethyl)-dimethylazanium bromide is sourced from PubChem (CID 14522795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).