C11H14F2N2O — CID 145228452
(4R,5S)-5-(3,4-difluorophenyl)-2-ethyl-1,2-oxazolidin-4-amine (PubChem CID 145228452) has the molecular formula C11H14F2N2O and a molecular weight of 228.24 g/mol. Its IUPAC name is (4R,5S)-5-(3,4-difluorophenyl)-2-ethyl-1,2-oxazolidin-4-amine.
| Compound Name | (4R,5S)-5-(3,4-difluorophenyl)-2-ethyl-1,2-oxazolidin-4-amine |
|---|---|
| PubChem CID | 145228452 |
| Molecular Formula | C11H14F2N2O |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | (4R,5S)-5-(3,4-difluorophenyl)-2-ethyl-1,2-oxazolidin-4-amine |
| SMILES | CCN1C[C@@H](N)[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C11H14F2N2O/c1-2-15-6-10(14)11(16-15)7-3-4-8(12)9(13)5-7/h3-5,10-11H,2,6,14H2,1H3/t10-,11+/m1/s1 |
| InChIKey | SLVSWNWWSFPERC-MNOVXSKESA-N |
| XLogP | 1.60 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |