C6H11F2NO — CID 145228806
(4R)-2-(2,2-difluoroethyl)-4-methyl-1,2-oxazolidine (PubChem CID 145228806) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is (4R)-2-(2,2-difluoroethyl)-4-methyl-1,2-oxazolidine.
| Compound Name | (4R)-2-(2,2-difluoroethyl)-4-methyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 145228806 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (4R)-2-(2,2-difluoroethyl)-4-methyl-1,2-oxazolidine |
| SMILES | C[C@H]1CON(CC(F)F)C1 |
| InChI | InChI=1S/C6H11F2NO/c1-5-2-9(10-4-5)3-6(7)8/h5-6H,2-4H2,1H3/t5-/m1/s1 |
| InChIKey | NVDLIZHXCVWKBQ-RXMQYKEDSA-N |
| XLogP | 1.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |