C12H15F2NO2 — CID 145229023
(5R)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidine (PubChem CID 145229023) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is (5R)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidine.
| Compound Name | (5R)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidine |
|---|---|
| PubChem CID | 145229023 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (5R)-5-(3,4-difluorophenyl)-2-(2-methoxyethyl)-1,2-oxazolidine |
| SMILES | COCCN1CC[C@H](c2ccc(F)c(F)c2)O1 |
| InChI | InChI=1S/C12H15F2NO2/c1-16-7-6-15-5-4-12(17-15)9-2-3-10(13)11(14)8-9/h2-3,8,12H,4-7H2,1H3/t12-/m1/s1 |
| InChIKey | MFJUAFXRAFFDRT-GFCCVEGCSA-N |
| XLogP | 2.29 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |