C13H28N4O — CID 145229928
1-[4-[[(Z)-2-hydrazinylethenyl]amino]piperidin-1-yl]ethanone;2-methylpropane (PubChem CID 145229928) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-[4-[[(Z)-2-hydrazinylethenyl]amino]piperidin-1-yl]ethanone;2-methylpropane.
| Compound Name | 1-[4-[[(Z)-2-hydrazinylethenyl]amino]piperidin-1-yl]ethanone;2-methylpropane |
|---|---|
| PubChem CID | 145229928 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | 1-[4-[[(Z)-2-hydrazinylethenyl]amino]piperidin-1-yl]ethanone;2-methylpropane |
| SMILES | CC(=O)N1CCC(N/C=C\NN)CC1.CC(C)C |
| InChI | InChI=1S/C9H18N4O.C4H10/c1-8(14)13-6-2-9(3-7-13)11-4-5-12-10;1-4(2)3/h4-5,9,11-12H,2-3,6-7,10H2,1H3;4H,1-3H3/b5-4-; |
| InChIKey | OSJKOMMNPNVRAE-MKWAYWHRSA-N |
| XLogP | 1.18 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|