About azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine
azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine (PubChem CID 145230008) has the molecular formula C10H24N4
and a molecular weight of 200.33 g/mol. Its IUPAC name is azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine |
| PubChem CID | 145230008 |
| Molecular Formula | C10H24N4 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.20 |
| IUPAC Name | azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine |
| SMILES | CCN1CCC(N/C=C(/C)N)CC1.N |
| InChI | InChI=1S/C10H21N3.H3N/c1-3-13-6-4-10(5-7-13)12-8-9(2)11;/h8,10,12H,3-7,11H2,1-2H3;1H3/b9-8-; |
| InChIKey | NCFVNHOSIASHRY-UOQXYWCXSA-N |
| XLogP | 1.04 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine?
The IUPAC name of azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine (CID 145230008) is azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine.
What is the SMILES notation for azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine?
The canonical SMILES for azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine is CCN1CCC(N/C=C(/C)N)CC1.N.
What is the InChIKey of azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine?
The InChIKey is NCFVNHOSIASHRY-UOQXYWCXSA-N. The full InChI is InChI=1S/C10H21N3.H3N/c1-3-13-6-4-10(5-7-13)12-8-9(2)11;/h8,10,12H,3-7,11H2,1-2H3;1H3/b9-8-;.
What are the key properties of azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine?
azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine has a molecular weight of 200.33 g/mol, XLogP of 1.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(Z)-1-N-(1-ethylpiperidin-4-yl)prop-1-ene-1,2-diamine is sourced from PubChem (CID 145230008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).