About azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine
azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine (PubChem CID 145230026) has the molecular formula C14H28F2N4
and a molecular weight of 290.40 g/mol. Its IUPAC name is azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine.
Molecular Properties
| Compound Name | azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine |
| PubChem CID | 145230026 |
| Molecular Formula | C14H28F2N4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine |
| SMILES | CC(C)/C(N)=C/NC1CCN(C2CC(F)(F)C2)CC1.N |
| InChI | InChI=1S/C14H25F2N3.H3N/c1-10(2)13(17)9-18-11-3-5-19(6-4-11)12-7-14(15,16)8-12;/h9-12,18H,3-8,17H2,1-2H3;1H3/b13-9-; |
| InChIKey | FDBKGZNDCFXIRL-CHHCPSLASA-N |
| XLogP | 2.46 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine?
The IUPAC name of azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine (CID 145230026) is azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine.
What is the SMILES notation for azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine?
The canonical SMILES for azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine is CC(C)/C(N)=C/NC1CCN(C2CC(F)(F)C2)CC1.N.
What is the InChIKey of azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine?
The InChIKey is FDBKGZNDCFXIRL-CHHCPSLASA-N. The full InChI is InChI=1S/C14H25F2N3.H3N/c1-10(2)13(17)9-18-11-3-5-19(6-4-11)12-7-14(15,16)8-12;/h9-12,18H,3-8,17H2,1-2H3;1H3/b13-9-;.
What are the key properties of azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine?
azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine has a molecular weight of 290.40 g/mol, XLogP of 2.46, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(Z)-1-N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-3-methylbut-1-ene-1,2-diamine is sourced from PubChem (CID 145230026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).