About but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine
but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine (PubChem CID 145230942) has the molecular formula C24H31N
and a molecular weight of 333.52 g/mol. Its IUPAC name is but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine.
Molecular Properties
| Compound Name | but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine |
| PubChem CID | 145230942 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine |
| SMILES | C/C=C(/C)c1ncc(-c2cccc(C)c2)cc1C.C=C(CC)C1CC1 |
| InChI | InChI=1S/C17H19N.C7H12/c1-5-13(3)17-14(4)10-16(11-18-17)15-8-6-7-12(2)9-15;1-3-6(2)7-4-5-7/h5-11H,1-4H3;7H,2-5H2,1H3/b13-5-; |
| InChIKey | NMZULEGWDJWVIP-UCHKSFBOSA-N |
| XLogP | 7.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine?
The IUPAC name of but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine (CID 145230942) is but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine.
What is the SMILES notation for but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine?
The canonical SMILES for but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine is C/C=C(/C)c1ncc(-c2cccc(C)c2)cc1C.C=C(CC)C1CC1.
What is the InChIKey of but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine?
The InChIKey is NMZULEGWDJWVIP-UCHKSFBOSA-N. The full InChI is InChI=1S/C17H19N.C7H12/c1-5-13(3)17-14(4)10-16(11-18-17)15-8-6-7-12(2)9-15;1-3-6(2)7-4-5-7/h5-11H,1-4H3;7H,2-5H2,1H3/b13-5-;.
What are the key properties of but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine?
but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine has a molecular weight of 333.52 g/mol, XLogP of 7.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-1-en-2-ylcyclopropane;2-[(Z)-but-2-en-2-yl]-3-methyl-5-(3-methylphenyl)pyridine is sourced from PubChem (CID 145230942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).