C16H16ClN3O3S — CID 145231011
7-[(5-chloro-2-methoxyphenyl)sulfanylamino]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one (PubChem CID 145231011) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is 7-[(5-chloro-2-methoxyphenyl)sulfanylamino]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one.
| Compound Name | 7-[(5-chloro-2-methoxyphenyl)sulfanylamino]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |
|---|---|
| PubChem CID | 145231011 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 7-[(5-chloro-2-methoxyphenyl)sulfanylamino]-4-methyl-2,3-dihydropyrido[3,2-f][1,4]oxazepin-5-one |
| SMILES | COc1ccc(Cl)cc1SNc1cnc2c(c1)C(=O)N(C)CCO2 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-20-5-6-23-15-12(16(20)21)8-11(9-18-15)19-24-14-7-10(17)3-4-13(14)22-2/h3-4,7-9,19H,5-6H2,1-2H3 |
| InChIKey | DSLHSVMALSKAKL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|