C18H33BO2 — CID 145231205
2-(4-tert-butylcyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane (PubChem CID 145231205) has the molecular formula C18H33BO2 and a molecular weight of 292.27 g/mol. Its IUPAC name is 2-(4-tert-butylcyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane.
| Compound Name | 2-(4-tert-butylcyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145231205 |
| Molecular Formula | C18H33BO2 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.26 |
| IUPAC Name | 2-(4-tert-butylcyclohexen-1-yl)-4,4,5-trimethyl-5-propan-2-yl-1,3,2-dioxaborolane |
| SMILES | CC(C)C1(C)OB(C2=CCC(C(C)(C)C)CC2)OC1(C)C |
| InChI | InChI=1S/C18H33BO2/c1-13(2)18(8)17(6,7)20-19(21-18)15-11-9-14(10-12-15)16(3,4)5/h11,13-14H,9-10,12H2,1-8H3 |
| InChIKey | WKJHUYOHDMPGHG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|