C42H49ClN2O5S — CID 145231206
N-[4-(4-chloro-2-methylphenyl)phenyl]-2-[4-[4-(1-methylcyclopropyl)cyclohexen-1-yl]phenyl]acetamide;2-(methylamino)ethanesulfonic acid;4-methylbenzaldehyde (PubChem CID 145231206) has the molecular formula C42H49ClN2O5S and a molecular weight of 729.38 g/mol. Its IUPAC name is N-[4-(4-chloro-2-methylphenyl)phenyl]-2-[4-[4-(1-methylcyclopropyl)cyclohexen-1-yl]phenyl]acetamide;2-(methylamino)ethanesulfonic acid;4-methylbenzaldehyde.
| Compound Name | N-[4-(4-chloro-2-methylphenyl)phenyl]-2-[4-[4-(1-methylcyclopropyl)cyclohexen-1-yl]phenyl]acetamide;2-(methylamino)ethanesulfonic acid;4-methylbenzaldehyde |
|---|---|
| PubChem CID | 145231206 |
| Molecular Formula | C42H49ClN2O5S |
| Molecular Weight | 729.38 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | N-[4-(4-chloro-2-methylphenyl)phenyl]-2-[4-[4-(1-methylcyclopropyl)cyclohexen-1-yl]phenyl]acetamide;2-(methylamino)ethanesulfonic acid;4-methylbenzaldehyde |
| SMILES | CNCCS(=O)(=O)O.Cc1cc(Cl)ccc1-c1ccc(NC(=O)Cc2ccc(C3=CCC(C4(C)CC4)CC3)cc2)cc1.Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C31H32ClNO.C8H8O.C3H9NO3S/c1-21-19-27(32)13-16-29(21)25-9-14-28(15-10-25)33-30(34)20-22-3-5-23(6-4-22)24-7-11-26(12-8-24)31(2)17-18-31;1-7-2-4-8(6-9)5-3-7;1-4-2-3-8(5,6)7/h3-7,9-10,13-16,19,26H,8,11-12,17-18,20H2,1-2H3,(H,33,34);2-6H,1H3;4H,2-3H2,1H3,(H,5,6,7) |
| InChIKey | HQYAAQXCVZWKLC-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.38 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|